C19H28O6 — CID 73057850
[(4R,5R)-5-[(4R,5R)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol (PubChem CID 73057850) has the molecular formula C19H28O6 and a molecular weight of 352.43 g/mol. Its IUPAC name is [(4R,5R)-5-[(4R,5R)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol.
| Compound Name | [(4R,5R)-5-[(4R,5R)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 73057850 |
| Molecular Formula | C19H28O6 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | [(4R,5R)-5-[(4R,5R)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
| SMILES | CC1(C)O[C@@H]([C@@H]2OC(C)(C)O[C@@H]2COCc2ccccc2)[C@@H](CO)O1 |
| InChI | InChI=1S/C19H28O6/c1-18(2)22-14(10-20)16(24-18)17-15(23-19(3,4)25-17)12-21-11-13-8-6-5-7-9-13/h5-9,14-17,20H,10-12H2,1-4H3/t14-,15-,16-,17-/m1/s1 |
| InChIKey | VSJVDWVWDTVNBY-QBPKDAKJSA-N |
| XLogP | 2.24 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |