C19H27IO5 — CID 134880472
(4S,5R)-4-[(4R,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]-5-(iodomethyl)-2,2-dimethyl-1,3-dioxolane (PubChem CID 134880472) has the molecular formula C19H27IO5 and a molecular weight of 462.32 g/mol. Its IUPAC name is (4S,5R)-4-[(4R,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]-5-(iodomethyl)-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4S,5R)-4-[(4R,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]-5-(iodomethyl)-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 134880472 |
| Molecular Formula | C19H27IO5 |
| Molecular Weight | 462.32 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | (4S,5R)-4-[(4R,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]-5-(iodomethyl)-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)O[C@@H]([C@@H]2OC(C)(C)O[C@H]2COCc2ccccc2)[C@H](CI)O1 |
| InChI | InChI=1S/C19H27IO5/c1-18(2)22-14(10-20)16(24-18)17-15(23-19(3,4)25-17)12-21-11-13-8-6-5-7-9-13/h5-9,14-17H,10-12H2,1-4H3/t14-,15-,16+,17+/m0/s1 |
| InChIKey | NMUPBZRXAFYBDV-MWDXBVQZSA-N |
| XLogP | 3.68 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.32 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|