C19H24O7 — CID 53343323
[(1'R,3'aS,4S,11'aR)-2,2-dimethylspiro[1,3-dioxolane-4,3'-3a,5,10,11a-tetrahydro-1H-furo[3,4-c][2,5]benzodioxocine]-1'-yl]methyl acetate (PubChem CID 53343323) has the molecular formula C19H24O7 and a molecular weight of 364.39 g/mol. Its IUPAC name is [(1'R,3'aS,4S,11'aR)-2,2-dimethylspiro[1,3-dioxolane-4,3'-3a,5,10,11a-tetrahydro-1H-furo[3,4-c][2,5]benzodioxocine]-1'-yl]methyl acetate.
| Compound Name | [(1'R,3'aS,4S,11'aR)-2,2-dimethylspiro[1,3-dioxolane-4,3'-3a,5,10,11a-tetrahydro-1H-furo[3,4-c][2,5]benzodioxocine]-1'-yl]methyl acetate |
|---|---|
| PubChem CID | 53343323 |
| Molecular Formula | C19H24O7 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | [(1'R,3'aS,4S,11'aR)-2,2-dimethylspiro[1,3-dioxolane-4,3'-3a,5,10,11a-tetrahydro-1H-furo[3,4-c][2,5]benzodioxocine]-1'-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@]2(COC(C)(C)O2)[C@H]2OCc3ccccc3CO[C@H]12 |
| InChI | InChI=1S/C19H24O7/c1-12(20)21-10-15-16-17(19(25-15)11-24-18(2,3)26-19)23-9-14-7-5-4-6-13(14)8-22-16/h4-7,15-17H,8-11H2,1-3H3/t15-,16-,17+,19+/m1/s1 |
| InChIKey | DNQCHPGDEVYPBF-VXNCWWDNSA-N |
| XLogP | 1.91 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |