C15H22O9 — CID 74037994
(8,9-diacetyloxy-2,2-dimethyl-1,3,6-trioxaspiro[4.4]nonan-7-yl)methyl acetate (PubChem CID 74037994) has the molecular formula C15H22O9 and a molecular weight of 346.33 g/mol. Its IUPAC name is (8,9-diacetyloxy-2,2-dimethyl-1,3,6-trioxaspiro[4.4]nonan-7-yl)methyl acetate.
| Compound Name | (8,9-diacetyloxy-2,2-dimethyl-1,3,6-trioxaspiro[4.4]nonan-7-yl)methyl acetate |
|---|---|
| PubChem CID | 74037994 |
| Molecular Formula | C15H22O9 |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | (8,9-diacetyloxy-2,2-dimethyl-1,3,6-trioxaspiro[4.4]nonan-7-yl)methyl acetate |
| SMILES | CC(=O)OCC1OC2(COC(C)(C)O2)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C15H22O9/c1-8(16)19-6-11-12(21-9(2)17)13(22-10(3)18)15(23-11)7-20-14(4,5)24-15/h11-13H,6-7H2,1-5H3 |
| InChIKey | KHRYOHKWLRNWKW-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|