C15H21NO11 — CID 85395163
(3,4,5-triacetyloxy-6-carbamoyl-6-hydroxyoxan-2-yl)methyl acetate (PubChem CID 85395163) has the molecular formula C15H21NO11 and a molecular weight of 391.33 g/mol. Its IUPAC name is (3,4,5-triacetyloxy-6-carbamoyl-6-hydroxyoxan-2-yl)methyl acetate.
| Compound Name | (3,4,5-triacetyloxy-6-carbamoyl-6-hydroxyoxan-2-yl)methyl acetate |
|---|---|
| PubChem CID | 85395163 |
| Molecular Formula | C15H21NO11 |
| Molecular Weight | 391.33 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | (3,4,5-triacetyloxy-6-carbamoyl-6-hydroxyoxan-2-yl)methyl acetate |
| SMILES | CC(=O)OCC1OC(O)(C(N)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C15H21NO11/c1-6(17)23-5-10-11(24-7(2)18)12(25-8(3)19)13(26-9(4)20)15(22,27-10)14(16)21/h10-13,22H,5H2,1-4H3,(H2,16,21) |
| InChIKey | UQCDSFPUJABSNF-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 177.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.33 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|