C22H30O15 — CID 538577
[3,4,5,6-tetraacetyloxy-6-(1,2-diacetyloxyethyl)oxan-2-yl]methyl acetate (PubChem CID 538577) has the molecular formula C22H30O15 and a molecular weight of 534.47 g/mol. Its IUPAC name is [3,4,5,6-tetraacetyloxy-6-(1,2-diacetyloxyethyl)oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5,6-tetraacetyloxy-6-(1,2-diacetyloxyethyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 538577 |
| Molecular Formula | C22H30O15 |
| Molecular Weight | 534.47 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | [3,4,5,6-tetraacetyloxy-6-(1,2-diacetyloxyethyl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(OC(C)=O)(C(COC(C)=O)OC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C22H30O15/c1-10(23)30-8-17-19(33-13(4)26)20(34-14(5)27)21(35-15(6)28)22(37-17,36-16(7)29)18(32-12(3)25)9-31-11(2)24/h17-21H,8-9H2,1-7H3 |
| InChIKey | MFYYLYYQLRNQLI-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 193.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.47 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|