C15H22O7 — CID 135224019
[(3S,6R)-1,4-diacetyloxy-6-propan-2-yl-2-oxabicyclo[3.1.0]hexan-3-yl]methyl acetate (PubChem CID 135224019) has the molecular formula C15H22O7 and a molecular weight of 314.33 g/mol. Its IUPAC name is [(3S,6R)-1,4-diacetyloxy-6-propan-2-yl-2-oxabicyclo[3.1.0]hexan-3-yl]methyl acetate.
| Compound Name | [(3S,6R)-1,4-diacetyloxy-6-propan-2-yl-2-oxabicyclo[3.1.0]hexan-3-yl]methyl acetate |
|---|---|
| PubChem CID | 135224019 |
| Molecular Formula | C15H22O7 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | [(3S,6R)-1,4-diacetyloxy-6-propan-2-yl-2-oxabicyclo[3.1.0]hexan-3-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1OC2(OC(C)=O)C(C1OC(C)=O)[C@H]2C(C)C |
| InChI | InChI=1S/C15H22O7/c1-7(2)12-13-14(20-9(4)17)11(6-19-8(3)16)22-15(12,13)21-10(5)18/h7,11-14H,6H2,1-5H3/t11-,12+,13?,14?,15?/m0/s1 |
| InChIKey | RQRZAVPCSCZJFB-PBWBXLIUSA-N |
| XLogP | 1.04 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|