C14H21NO10 — CID 70565465
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-amino-6-hydroxyoxan-2-yl]methyl acetate (PubChem CID 70565465) has the molecular formula C14H21NO10 and a molecular weight of 363.32 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-amino-6-hydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-amino-6-hydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 70565465 |
| Molecular Formula | C14H21NO10 |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-amino-6-hydroxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@](N)(O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C14H21NO10/c1-6(16)21-5-10-11(22-7(2)17)12(23-8(3)18)13(24-9(4)19)14(15,20)25-10/h10-13,20H,5,15H2,1-4H3/t10-,11-,12+,13-,14-/m1/s1 |
| InChIKey | SGAASNQTXSMYTA-RKQHYHRCSA-N |
| XLogP | -1.65 |
| TPSA | 160.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|