C16H21N3O11 — CID 102215688
methyl (2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)-2-azidooxane-2-carboxylate (PubChem CID 102215688) has the molecular formula C16H21N3O11 and a molecular weight of 431.35 g/mol. Its IUPAC name is methyl (2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)-2-azidooxane-2-carboxylate.
| Compound Name | methyl (2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)-2-azidooxane-2-carboxylate |
|---|---|
| PubChem CID | 102215688 |
| Molecular Formula | C16H21N3O11 |
| Molecular Weight | 431.35 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | methyl (2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)-2-azidooxane-2-carboxylate |
| SMILES | COC(=O)[C@@]1(N=[N+]=[N-])O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C16H21N3O11/c1-7(20)26-6-11-12(27-8(2)21)13(28-9(3)22)14(29-10(4)23)16(30-11,18-19-17)15(24)25-5/h11-14H,6H2,1-5H3/t11-,12+,13+,14-,16+/m1/s1 |
| InChIKey | DHOQJEWXASPUGJ-SRTKAIALSA-N |
| XLogP | -0.08 |
| TPSA | 189.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.35 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|