C8H13N3O7 — CID 11694592
methyl (2S,3R,4S,5S,6R)-2-azido-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxylate (PubChem CID 11694592) has the molecular formula C8H13N3O7 and a molecular weight of 263.21 g/mol. Its IUPAC name is methyl (2S,3R,4S,5S,6R)-2-azido-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxylate.
| Compound Name | methyl (2S,3R,4S,5S,6R)-2-azido-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxylate |
|---|---|
| PubChem CID | 11694592 |
| Molecular Formula | C8H13N3O7 |
| Molecular Weight | 263.21 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | methyl (2S,3R,4S,5S,6R)-2-azido-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxylate |
| SMILES | COC(=O)[C@@]1(N=[N+]=[N-])O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H13N3O7/c1-17-7(16)8(10-11-9)6(15)5(14)4(13)3(2-12)18-8/h3-6,12-15H,2H2,1H3/t3-,4-,5+,6-,8+/m1/s1 |
| InChIKey | JNNQQBFZKYKPJE-WVISBBDJSA-N |
| XLogP | -2.36 |
| TPSA | 165.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.21 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|