C8H13BrO6 — CID 153298032
1-[(3R,4S,5R,6R)-2-bromo-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-deuterioethanone (PubChem CID 153298032) has the molecular formula C8H13BrO6 and a molecular weight of 286.10 g/mol. Its IUPAC name is 1-[(3R,4S,5R,6R)-2-bromo-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-deuterioethanone.
| Compound Name | 1-[(3R,4S,5R,6R)-2-bromo-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-deuterioethanone |
|---|---|
| PubChem CID | 153298032 |
| Molecular Formula | C8H13BrO6 |
| Molecular Weight | 286.10 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | 1-[(3R,4S,5R,6R)-2-bromo-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-deuterioethanone |
| SMILES | [2H]CC(=O)C1(Br)O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H13BrO6/c1-3(11)8(9)7(14)6(13)5(12)4(2-10)15-8/h4-7,10,12-14H,2H2,1H3/t4-,5+,6+,7-,8?/m1/s1/i1D |
| InChIKey | KHWOJIWDUARZGB-KSZMAAHLSA-N |
| XLogP | -1.86 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.10 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|