C15H18BrNO6 — CID 67706697
N-[(2R,3R,4R,5S,6R)-2-acetyl-2-bromo-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]benzamide (PubChem CID 67706697) has the molecular formula C15H18BrNO6 and a molecular weight of 388.21 g/mol. Its IUPAC name is N-[(2R,3R,4R,5S,6R)-2-acetyl-2-bromo-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]benzamide.
| Compound Name | N-[(2R,3R,4R,5S,6R)-2-acetyl-2-bromo-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]benzamide |
|---|---|
| PubChem CID | 67706697 |
| Molecular Formula | C15H18BrNO6 |
| Molecular Weight | 388.21 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | N-[(2R,3R,4R,5S,6R)-2-acetyl-2-bromo-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]benzamide |
| SMILES | CC(=O)[C@@]1(Br)O[C@H](CO)[C@@H](O)[C@H](O)C1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H18BrNO6/c1-8(19)15(16)13(12(21)11(20)10(7-18)23-15)17-14(22)9-5-3-2-4-6-9/h2-6,10-13,18,20-21H,7H2,1H3,(H,17,22)/t10-,11-,12+,13?,15-/m1/s1 |
| InChIKey | ORGKYQOWNVVONA-IPNSXDPFSA-N |
| XLogP | -0.42 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.21 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|