C14H18INO2 — CID 10991985
N-[(2S,3R)-2-(iodomethyl)-4,4-dimethyloxolan-3-yl]benzamide (PubChem CID 10991985) has the molecular formula C14H18INO2 and a molecular weight of 359.21 g/mol. Its IUPAC name is N-[(2S,3R)-2-(iodomethyl)-4,4-dimethyloxolan-3-yl]benzamide.
| Compound Name | N-[(2S,3R)-2-(iodomethyl)-4,4-dimethyloxolan-3-yl]benzamide |
|---|---|
| PubChem CID | 10991985 |
| Molecular Formula | C14H18INO2 |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | N-[(2S,3R)-2-(iodomethyl)-4,4-dimethyloxolan-3-yl]benzamide |
| SMILES | CC1(C)CO[C@H](CI)[C@@H]1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H18INO2/c1-14(2)9-18-11(8-15)12(14)16-13(17)10-6-4-3-5-7-10/h3-7,11-12H,8-9H2,1-2H3,(H,16,17)/t11-,12+/m1/s1 |
| InChIKey | OJBDONBELAOVKS-NEPJUHHUSA-N |
| XLogP | 2.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|