C8H13BrO7 — CID 141213691
1-[(3R,4S,5S,6R)-2-bromo-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-3-yl]ethanone (PubChem CID 141213691) has the molecular formula C8H13BrO7 and a molecular weight of 301.09 g/mol. Its IUPAC name is 1-[(3R,4S,5S,6R)-2-bromo-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-3-yl]ethanone.
| Compound Name | 1-[(3R,4S,5S,6R)-2-bromo-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-3-yl]ethanone |
|---|---|
| PubChem CID | 141213691 |
| Molecular Formula | C8H13BrO7 |
| Molecular Weight | 301.09 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | 1-[(3R,4S,5S,6R)-2-bromo-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-3-yl]ethanone |
| SMILES | CC(=O)[C@]1(O)[C@@H](O)[C@H](O)[C@@H](CO)OC1(O)Br |
| InChI | InChI=1S/C8H13BrO7/c1-3(11)7(14)6(13)5(12)4(2-10)16-8(7,9)15/h4-6,10,12-15H,2H2,1H3/t4-,5-,6+,7+,8?/m1/s1 |
| InChIKey | OZUMXPOCHLGNQL-WZPXOXCRSA-N |
| XLogP | -2.54 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.09 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|