C8H15NO7 — CID 140653624
1-[(2R,3R,4S,5S,6R)-3-amino-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]ethanone (PubChem CID 140653624) has the molecular formula C8H15NO7 and a molecular weight of 237.21 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5S,6R)-3-amino-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]ethanone.
| Compound Name | 1-[(2R,3R,4S,5S,6R)-3-amino-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]ethanone |
|---|---|
| PubChem CID | 140653624 |
| Molecular Formula | C8H15NO7 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 1-[(2R,3R,4S,5S,6R)-3-amino-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]ethanone |
| SMILES | CC(=O)[C@]1(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@@]1(N)O |
| InChI | InChI=1S/C8H15NO7/c1-3(11)8(15)7(9,14)6(13)5(12)4(2-10)16-8/h4-6,10,12-15H,2,9H2,1H3/t4-,5-,6+,7-,8+/m1/s1 |
| InChIKey | NSEPIMSRQCBUTF-CBQIKETKSA-N |
| XLogP | -3.98 |
| TPSA | 153.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | -3.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|