C8H18NO10P — CID 141008543
1-[(2R,3R,4R,5S,6R)-3-amino-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethanone;phosphoric acid (PubChem CID 141008543) has the molecular formula C8H18NO10P and a molecular weight of 319.20 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5S,6R)-3-amino-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethanone;phosphoric acid.
| Compound Name | 1-[(2R,3R,4R,5S,6R)-3-amino-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethanone;phosphoric acid |
|---|---|
| PubChem CID | 141008543 |
| Molecular Formula | C8H18NO10P |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 1-[(2R,3R,4R,5S,6R)-3-amino-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethanone;phosphoric acid |
| SMILES | CC(=O)[C@]1(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N.O=P(O)(O)O |
| InChI | InChI=1S/C8H15NO6.H3O4P/c1-3(11)8(14)7(9)6(13)5(12)4(2-10)15-8;1-5(2,3)4/h4-7,10,12-14H,2,9H2,1H3;(H3,1,2,3,4)/t4-,5-,6+,7-,8+;/m1./s1 |
| InChIKey | JHVGZSJOQBRMBQ-BCSHSFFVSA-N |
| XLogP | -4.22 |
| TPSA | 211.00 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | -4.22 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|