C14H27NO6 — CID 141107812
1-[(3R,4R,5S,6R)-3-amino-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-deuteriooctan-1-one (PubChem CID 141107812) has the molecular formula C14H27NO6 and a molecular weight of 306.38 g/mol. Its IUPAC name is 1-[(3R,4R,5S,6R)-3-amino-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-deuteriooctan-1-one.
| Compound Name | 1-[(3R,4R,5S,6R)-3-amino-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-deuteriooctan-1-one |
|---|---|
| PubChem CID | 141107812 |
| Molecular Formula | C14H27NO6 |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 1-[(3R,4R,5S,6R)-3-amino-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-deuteriooctan-1-one |
| SMILES | [2H]C(CCCCCC)C(=O)C1(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N |
| InChI | InChI=1S/C14H27NO6/c1-2-3-4-5-6-7-10(17)14(20)13(15)12(19)11(18)9(8-16)21-14/h9,11-13,16,18-20H,2-8,15H2,1H3/t9-,11-,12+,13-,14?/m1/s1/i7D/t7?,9-,11-,12+,13-,14? |
| InChIKey | MEGIXDRJUCONRD-XXLLTMRESA-N |
| XLogP | -0.96 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|