C15H30O6 — CID 141242190
(3R,4S,5S,6R)-6-(hydroxymethyl)-2-nonyloxane-2,3,4,5-tetrol (PubChem CID 141242190) has the molecular formula C15H30O6 and a molecular weight of 306.40 g/mol. Its IUPAC name is (3R,4S,5S,6R)-6-(hydroxymethyl)-2-nonyloxane-2,3,4,5-tetrol.
| Compound Name | (3R,4S,5S,6R)-6-(hydroxymethyl)-2-nonyloxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 141242190 |
| Molecular Formula | C15H30O6 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | (3R,4S,5S,6R)-6-(hydroxymethyl)-2-nonyloxane-2,3,4,5-tetrol |
| SMILES | CCCCCCCCCC1(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H30O6/c1-2-3-4-5-6-7-8-9-15(20)14(19)13(18)12(17)11(10-16)21-15/h11-14,16-20H,2-10H2,1H3/t11-,12-,13+,14-,15?/m1/s1 |
| InChIKey | SJGJEYDYJQSOCX-HHHGZCDHSA-N |
| XLogP | 0.29 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|