C13H26O5S — CID 91406796
2-heptyl-6-(hydroxymethyl)-5-sulfanyloxane-2,3,4-triol (PubChem CID 91406796) has the molecular formula C13H26O5S and a molecular weight of 294.41 g/mol. Its IUPAC name is 2-heptyl-6-(hydroxymethyl)-5-sulfanyloxane-2,3,4-triol.
| Compound Name | 2-heptyl-6-(hydroxymethyl)-5-sulfanyloxane-2,3,4-triol |
|---|---|
| PubChem CID | 91406796 |
| Molecular Formula | C13H26O5S |
| Molecular Weight | 294.41 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 2-heptyl-6-(hydroxymethyl)-5-sulfanyloxane-2,3,4-triol |
| SMILES | CCCCCCCC1(O)OC(CO)C(S)C(O)C1O |
| InChI | InChI=1S/C13H26O5S/c1-2-3-4-5-6-7-13(17)12(16)10(15)11(19)9(8-14)18-13/h9-12,14-17,19H,2-8H2,1H3 |
| InChIKey | HLIOPORYMUJIFO-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.41 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|