C24H47NO5 — CID 70149269
(2R,3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)-2-[(Z)-octadec-9-enyl]oxane-2,4,5-triol (PubChem CID 70149269) has the molecular formula C24H47NO5 and a molecular weight of 429.64 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)-2-[(Z)-octadec-9-enyl]oxane-2,4,5-triol.
| Compound Name | (2R,3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)-2-[(Z)-octadec-9-enyl]oxane-2,4,5-triol |
|---|---|
| PubChem CID | 70149269 |
| Molecular Formula | C24H47NO5 |
| Molecular Weight | 429.64 g/mol |
| Exact Mass | 429.35 |
| IUPAC Name | (2R,3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)-2-[(Z)-octadec-9-enyl]oxane-2,4,5-triol |
| SMILES | CCCCCCCC/C=C\CCCCCCCC[C@@]1(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N |
| InChI | InChI=1S/C24H47NO5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24(29)23(25)22(28)21(27)20(19-26)30-24/h9-10,20-23,26-29H,2-8,11-19,25H2,1H3/b10-9-/t20-,21-,22+,23-,24-/m1/s1 |
| InChIKey | HMQBFYZEGPNIHY-BCPFAYIMSA-N |
| XLogP | 3.54 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.64 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|