C15H31NO5 — CID 174839075
(2R,3R,4R,5R)-5-amino-2-(hydroxymethyl)-6-(2-methylpropyl)-6-pentoxyoxane-3,4-diol (PubChem CID 174839075) has the molecular formula C15H31NO5 and a molecular weight of 305.42 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-amino-2-(hydroxymethyl)-6-(2-methylpropyl)-6-pentoxyoxane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-5-amino-2-(hydroxymethyl)-6-(2-methylpropyl)-6-pentoxyoxane-3,4-diol |
|---|---|
| PubChem CID | 174839075 |
| Molecular Formula | C15H31NO5 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | (2R,3R,4R,5R)-5-amino-2-(hydroxymethyl)-6-(2-methylpropyl)-6-pentoxyoxane-3,4-diol |
| SMILES | CCCCCOC1(CC(C)C)O[C@H](CO)[C@H](O)[C@H](O)[C@H]1N |
| InChI | InChI=1S/C15H31NO5/c1-4-5-6-7-20-15(8-10(2)3)14(16)13(19)12(18)11(9-17)21-15/h10-14,17-19H,4-9,16H2,1-3H3/t11-,12+,13+,14-,15?/m1/s1 |
| InChIKey | SPSYSCSWYJOIKW-GVLTWOEFSA-N |
| XLogP | 0.38 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|