C13H26O7 — CID 139696079
(2S,3S,4R,5R)-2-hexoxy-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol (PubChem CID 139696079) has the molecular formula C13H26O7 and a molecular weight of 294.34 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-hexoxy-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5R)-2-hexoxy-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 139696079 |
| Molecular Formula | C13H26O7 |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | (2S,3S,4R,5R)-2-hexoxy-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol |
| SMILES | CCCCCCO[C@]1(OC)OC(CO)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H26O7/c1-3-4-5-6-7-19-13(18-2)12(17)11(16)10(15)9(8-14)20-13/h9-12,14-17H,3-8H2,1-2H3/t9?,10-,11+,12-,13-/m0/s1 |
| InChIKey | LABKTNBMIGBCOA-DMGDTADUSA-N |
| XLogP | -0.64 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|