C10H20O6 — CID 154790998
(2R)-2-butoxy-2,5-bis(hydroxymethyl)oxolane-3,4-diol (PubChem CID 154790998) has the molecular formula C10H20O6 and a molecular weight of 236.26 g/mol. Its IUPAC name is (2R)-2-butoxy-2,5-bis(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R)-2-butoxy-2,5-bis(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 154790998 |
| Molecular Formula | C10H20O6 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | (2R)-2-butoxy-2,5-bis(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CCCCO[C@]1(CO)OC(CO)C(O)C1O |
| InChI | InChI=1S/C10H20O6/c1-2-3-4-15-10(6-12)9(14)8(13)7(5-11)16-10/h7-9,11-14H,2-6H2,1H3/t7?,8?,9?,10-/m1/s1 |
| InChIKey | XRGRZXPJJVQDJO-SYZWKDNESA-N |
| XLogP | -1.40 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|