C22H44O6 — CID 22879298
(3R,4S,5R,6R)-6-(hydroxymethyl)-2-octoxy-2-octyloxane-3,4,5-triol (PubChem CID 22879298) has the molecular formula C22H44O6 and a molecular weight of 404.59 g/mol. Its IUPAC name is (3R,4S,5R,6R)-6-(hydroxymethyl)-2-octoxy-2-octyloxane-3,4,5-triol.
| Compound Name | (3R,4S,5R,6R)-6-(hydroxymethyl)-2-octoxy-2-octyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 22879298 |
| Molecular Formula | C22H44O6 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.31 |
| IUPAC Name | (3R,4S,5R,6R)-6-(hydroxymethyl)-2-octoxy-2-octyloxane-3,4,5-triol |
| SMILES | CCCCCCCCOC1(CCCCCCCC)O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C22H44O6/c1-3-5-7-9-11-13-15-22(27-16-14-12-10-8-6-4-2)21(26)20(25)19(24)18(17-23)28-22/h18-21,23-26H,3-17H2,1-2H3/t18-,19+,20+,21-,22?/m1/s1 |
| InChIKey | ZYQIBFOZPFEFMV-LKIPPVDESA-N |
| XLogP | 3.28 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|