C20H42O9SSi — CID 123268661
[(3R,4S,5S,6R)-2-[2-[decyl(dimethyl)silyl]ethyl]-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] hydrogen sulfate (PubChem CID 123268661) has the molecular formula C20H42O9SSi and a molecular weight of 486.70 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-2-[2-[decyl(dimethyl)silyl]ethyl]-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] hydrogen sulfate.
| Compound Name | [(3R,4S,5S,6R)-2-[2-[decyl(dimethyl)silyl]ethyl]-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 123268661 |
| Molecular Formula | C20H42O9SSi |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | [(3R,4S,5S,6R)-2-[2-[decyl(dimethyl)silyl]ethyl]-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] hydrogen sulfate |
| SMILES | CCCCCCCCCC[Si](C)(C)CCC1(OS(=O)(=O)O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C20H42O9SSi/c1-4-5-6-7-8-9-10-11-13-31(2,3)14-12-20(29-30(25,26)27)19(24)18(23)17(22)16(15-21)28-20/h16-19,21-24H,4-15H2,1-3H3,(H,25,26,27)/t16-,17-,18+,19-,20?/m1/s1 |
| InChIKey | HGMORNQCMQAKOU-QUIYGKKVSA-N |
| XLogP | 2.22 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|