C8H15NaO9S — CID 102598037
sodium [(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-methoxyoxan-2-yl]methanesulfonate (PubChem CID 102598037) has the molecular formula C8H15NaO9S and a molecular weight of 310.26 g/mol. Its IUPAC name is sodium [(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-methoxyoxan-2-yl]methanesulfonate.
| Compound Name | sodium [(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-methoxyoxan-2-yl]methanesulfonate |
|---|---|
| PubChem CID | 102598037 |
| Molecular Formula | C8H15NaO9S |
| Molecular Weight | 310.26 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | sodium [(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-methoxyoxan-2-yl]methanesulfonate |
| SMILES | CO[C@@]1(CS(=O)(=O)[O-])O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O.[Na+] |
| InChI | InChI=1S/C8H16O9S.Na/c1-16-8(3-18(13,14)15)7(12)6(11)5(10)4(2-9)17-8;/h4-7,9-12H,2-3H2,1H3,(H,13,14,15);/q;+1/p-1/t4-,5-,6+,7-,8+;/m1./s1 |
| InChIKey | CAHNXGYDENKSTL-BCSHSFFVSA-M |
| XLogP | -6.65 |
| TPSA | 156.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.26 |
| LogP ≤ 5 | -6.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|