C7H13ClO5 — CID 130847553
(2S,3R,4S,5R)-2-(chloromethyl)-5-(hydroxymethyl)-2-methoxyoxolane-3,4-diol (PubChem CID 130847553) has the molecular formula C7H13ClO5 and a molecular weight of 212.63 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-(chloromethyl)-5-(hydroxymethyl)-2-methoxyoxolane-3,4-diol.
| Compound Name | (2S,3R,4S,5R)-2-(chloromethyl)-5-(hydroxymethyl)-2-methoxyoxolane-3,4-diol |
|---|---|
| PubChem CID | 130847553 |
| Molecular Formula | C7H13ClO5 |
| Molecular Weight | 212.63 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | (2S,3R,4S,5R)-2-(chloromethyl)-5-(hydroxymethyl)-2-methoxyoxolane-3,4-diol |
| SMILES | CO[C@]1(CCl)O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C7H13ClO5/c1-12-7(3-8)6(11)5(10)4(2-9)13-7/h4-6,9-11H,2-3H2,1H3/t4-,5-,6-,7-/m1/s1 |
| InChIKey | BBQFSKZUEDXCHY-DBRKOABJSA-N |
| XLogP | -1.32 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.63 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|