C12H19Cl3O8 — CID 140847017
(2R,4S,5R)-2-[(2R,3R,5S)-2,5-bis(chloromethyl)-3,4-dihydroxyoxolan-2-yl]oxy-5-chloro-6-(hydroxymethyl)oxane-3,4-diol (PubChem CID 140847017) has the molecular formula C12H19Cl3O8 and a molecular weight of 397.64 g/mol. Its IUPAC name is (2R,4S,5R)-2-[(2R,3R,5S)-2,5-bis(chloromethyl)-3,4-dihydroxyoxolan-2-yl]oxy-5-chloro-6-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (2R,4S,5R)-2-[(2R,3R,5S)-2,5-bis(chloromethyl)-3,4-dihydroxyoxolan-2-yl]oxy-5-chloro-6-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 140847017 |
| Molecular Formula | C12H19Cl3O8 |
| Molecular Weight | 397.64 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | (2R,4S,5R)-2-[(2R,3R,5S)-2,5-bis(chloromethyl)-3,4-dihydroxyoxolan-2-yl]oxy-5-chloro-6-(hydroxymethyl)oxane-3,4-diol |
| SMILES | OCC1O[C@H](O[C@]2(CCl)O[C@H](CCl)C(O)[C@H]2O)C(O)[C@H](O)[C@H]1Cl |
| InChI | InChI=1S/C12H19Cl3O8/c13-1-4-7(17)10(20)12(3-14,22-4)23-11-9(19)8(18)6(15)5(2-16)21-11/h4-11,16-20H,1-3H2/t4-,5?,6+,7?,8-,9?,10-,11-,12+/m1/s1 |
| InChIKey | BAQAVOSOZGMPRM-NFQWICNISA-N |
| XLogP | -1.66 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.64 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|