C12H18Cl4O7 — CID 156614249
(2S,3S,4S,5S)-6-[(3S,4S,5S)-2,5-bis(chloromethyl)-3,4-dihydroxyoxolan-2-yl]oxy-5-chloro-2-(chloromethyl)oxane-3,4-diol (PubChem CID 156614249) has the molecular formula C12H18Cl4O7 and a molecular weight of 416.08 g/mol. Its IUPAC name is (2S,3S,4S,5S)-6-[(3S,4S,5S)-2,5-bis(chloromethyl)-3,4-dihydroxyoxolan-2-yl]oxy-5-chloro-2-(chloromethyl)oxane-3,4-diol.
| Compound Name | (2S,3S,4S,5S)-6-[(3S,4S,5S)-2,5-bis(chloromethyl)-3,4-dihydroxyoxolan-2-yl]oxy-5-chloro-2-(chloromethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 156614249 |
| Molecular Formula | C12H18Cl4O7 |
| Molecular Weight | 416.08 g/mol |
| Exact Mass | 413.98 |
| IUPAC Name | (2S,3S,4S,5S)-6-[(3S,4S,5S)-2,5-bis(chloromethyl)-3,4-dihydroxyoxolan-2-yl]oxy-5-chloro-2-(chloromethyl)oxane-3,4-diol |
| SMILES | O[C@@H]1[C@@H](CCl)OC(CCl)(OC2O[C@H](CCl)[C@@H](O)[C@H](O)[C@@H]2Cl)[C@H]1O |
| InChI | InChI=1S/C12H18Cl4O7/c13-1-4-7(17)9(19)6(16)11(21-4)23-12(3-15)10(20)8(18)5(2-14)22-12/h4-11,17-20H,1-3H2/t4-,5-,6+,7-,8-,9-,10+,11?,12?/m1/s1 |
| InChIKey | NQVNCSZMFVIZQP-MKRNPNCRSA-N |
| XLogP | -0.41 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.08 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|