C12H21Cl3O9 — CID 139058741
(2R,3R,4R,5S,6R)-2-[(2R,3S,4S,5S)-2,5-bis(chloromethyl)-3,4-dihydroxyoxolan-2-yl]oxy-5-chloro-6-(hydroxymethyl)oxane-3,4-diol;hydrate (PubChem CID 139058741) has the molecular formula C12H21Cl3O9 and a molecular weight of 415.65 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-2-[(2R,3S,4S,5S)-2,5-bis(chloromethyl)-3,4-dihydroxyoxolan-2-yl]oxy-5-chloro-6-(hydroxymethyl)oxane-3,4-diol;hydrate.
| Compound Name | (2R,3R,4R,5S,6R)-2-[(2R,3S,4S,5S)-2,5-bis(chloromethyl)-3,4-dihydroxyoxolan-2-yl]oxy-5-chloro-6-(hydroxymethyl)oxane-3,4-diol;hydrate |
|---|---|
| PubChem CID | 139058741 |
| Molecular Formula | C12H21Cl3O9 |
| Molecular Weight | 415.65 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | (2R,3R,4R,5S,6R)-2-[(2R,3S,4S,5S)-2,5-bis(chloromethyl)-3,4-dihydroxyoxolan-2-yl]oxy-5-chloro-6-(hydroxymethyl)oxane-3,4-diol;hydrate |
| SMILES | O.OC[C@H]1O[C@H](O[C@]2(CCl)O[C@H](CCl)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1Cl |
| InChI | InChI=1S/C12H19Cl3O8.H2O/c13-1-4-7(17)10(20)12(3-14,22-4)23-11-9(19)8(18)6(15)5(2-16)21-11;/h4-11,16-20H,1-3H2;1H2/t4-,5-,6-,7-,8+,9-,10+,11-,12+;/m1./s1 |
| InChIKey | SWCQIVSDHZBDPS-AKSHDPDZSA-N |
| XLogP | -2.48 |
| TPSA | 160.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.65 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|