C13H21Cl3O7 — CID 59809170
(2S,4R,5R)-2-[(2R,3R,5R)-2,5-bis(chloromethyl)-3,4-dihydroxyoxolan-2-yl]oxy-5-chloro-6-ethyloxane-3,4-diol (PubChem CID 59809170) has the molecular formula C13H21Cl3O7 and a molecular weight of 395.66 g/mol. Its IUPAC name is (2S,4R,5R)-2-[(2R,3R,5R)-2,5-bis(chloromethyl)-3,4-dihydroxyoxolan-2-yl]oxy-5-chloro-6-ethyloxane-3,4-diol.
| Compound Name | (2S,4R,5R)-2-[(2R,3R,5R)-2,5-bis(chloromethyl)-3,4-dihydroxyoxolan-2-yl]oxy-5-chloro-6-ethyloxane-3,4-diol |
|---|---|
| PubChem CID | 59809170 |
| Molecular Formula | C13H21Cl3O7 |
| Molecular Weight | 395.66 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | (2S,4R,5R)-2-[(2R,3R,5R)-2,5-bis(chloromethyl)-3,4-dihydroxyoxolan-2-yl]oxy-5-chloro-6-ethyloxane-3,4-diol |
| SMILES | CCC1O[C@@H](O[C@]2(CCl)O[C@@H](CCl)C(O)[C@H]2O)C(O)[C@@H](O)[C@H]1Cl |
| InChI | InChI=1S/C13H21Cl3O7/c1-2-5-7(16)9(18)10(19)12(21-5)23-13(4-15)11(20)8(17)6(3-14)22-13/h5-12,17-20H,2-4H2,1H3/t5?,6-,7-,8?,9-,10?,11+,12-,13-/m0/s1 |
| InChIKey | FHAWEXMCXHOCBE-UCWCGWDJSA-N |
| XLogP | -0.24 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.66 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|