C13H21Cl3O8 — CID 70466709
(2R,3R,4R,5R,6R)-2-[(2R,3S,4S,5S)-2,5-bis(chloromethyl)-3,4-dihydroxyoxolan-2-yl]oxy-5-chloro-6-(methoxymethyl)oxane-3,4-diol (PubChem CID 70466709) has the molecular formula C13H21Cl3O8 and a molecular weight of 411.66 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-2-[(2R,3S,4S,5S)-2,5-bis(chloromethyl)-3,4-dihydroxyoxolan-2-yl]oxy-5-chloro-6-(methoxymethyl)oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5R,6R)-2-[(2R,3S,4S,5S)-2,5-bis(chloromethyl)-3,4-dihydroxyoxolan-2-yl]oxy-5-chloro-6-(methoxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 70466709 |
| Molecular Formula | C13H21Cl3O8 |
| Molecular Weight | 411.66 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | (2R,3R,4R,5R,6R)-2-[(2R,3S,4S,5S)-2,5-bis(chloromethyl)-3,4-dihydroxyoxolan-2-yl]oxy-5-chloro-6-(methoxymethyl)oxane-3,4-diol |
| SMILES | COC[C@H]1O[C@H](O[C@]2(CCl)O[C@H](CCl)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1Cl |
| InChI | InChI=1S/C13H21Cl3O8/c1-21-3-6-7(16)9(18)10(19)12(22-6)24-13(4-15)11(20)8(17)5(2-14)23-13/h5-12,17-20H,2-4H2,1H3/t5-,6-,7+,8-,9+,10-,11+,12-,13+/m1/s1 |
| InChIKey | XUECYQGOMBXBDV-XIBJMIMQSA-N |
| XLogP | -1.00 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.66 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|