C12H18BrCl3O7 — CID 156614229
(3R,4R,5R,6R)-2-[(3R,4S,5R)-4-bromo-2,5-bis(chloromethyl)-3-hydroxyoxolan-2-yl]oxy-5-chloro-6-(hydroxymethyl)oxane-3,4-diol (PubChem CID 156614229) has the molecular formula C12H18BrCl3O7 and a molecular weight of 460.53 g/mol. Its IUPAC name is (3R,4R,5R,6R)-2-[(3R,4S,5R)-4-bromo-2,5-bis(chloromethyl)-3-hydroxyoxolan-2-yl]oxy-5-chloro-6-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (3R,4R,5R,6R)-2-[(3R,4S,5R)-4-bromo-2,5-bis(chloromethyl)-3-hydroxyoxolan-2-yl]oxy-5-chloro-6-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 156614229 |
| Molecular Formula | C12H18BrCl3O7 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 457.93 |
| IUPAC Name | (3R,4R,5R,6R)-2-[(3R,4S,5R)-4-bromo-2,5-bis(chloromethyl)-3-hydroxyoxolan-2-yl]oxy-5-chloro-6-(hydroxymethyl)oxane-3,4-diol |
| SMILES | OC[C@H]1OC(OC2(CCl)O[C@H](CCl)[C@@H](Br)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1Cl |
| InChI | InChI=1S/C12H18BrCl3O7/c13-6-4(1-14)22-12(3-15,10(6)20)23-11-9(19)8(18)7(16)5(2-17)21-11/h4-11,17-20H,1-3H2/t4-,5-,6-,7+,8+,9-,10+,11?,12?/m1/s1 |
| InChIKey | JYPJBAAJYHXKOP-NTJQKGQBSA-N |
| XLogP | -0.25 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|