C12H18Cl3IO7 — CID 14558770
(2R,3R,4R,5R,6R)-2-[(2R,3R,4S,5R)-2,5-bis(chloromethyl)-3-hydroxy-4-iodooxolan-2-yl]oxy-5-chloro-6-(hydroxymethyl)oxane-3,4-diol (PubChem CID 14558770) has the molecular formula C12H18Cl3IO7 and a molecular weight of 507.53 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-2-[(2R,3R,4S,5R)-2,5-bis(chloromethyl)-3-hydroxy-4-iodooxolan-2-yl]oxy-5-chloro-6-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5R,6R)-2-[(2R,3R,4S,5R)-2,5-bis(chloromethyl)-3-hydroxy-4-iodooxolan-2-yl]oxy-5-chloro-6-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 14558770 |
| Molecular Formula | C12H18Cl3IO7 |
| Molecular Weight | 507.53 g/mol |
| Exact Mass | 505.92 |
| IUPAC Name | (2R,3R,4R,5R,6R)-2-[(2R,3R,4S,5R)-2,5-bis(chloromethyl)-3-hydroxy-4-iodooxolan-2-yl]oxy-5-chloro-6-(hydroxymethyl)oxane-3,4-diol |
| SMILES | OC[C@H]1O[C@H](O[C@]2(CCl)O[C@H](CCl)[C@@H](I)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1Cl |
| InChI | InChI=1S/C12H18Cl3IO7/c13-1-4-7(16)10(20)12(3-14,22-4)23-11-9(19)8(18)6(15)5(2-17)21-11/h4-11,17-20H,1-3H2/t4-,5-,6+,7-,8+,9-,10+,11-,12+/m1/s1 |
| InChIKey | BPICFHYOPYWBFS-QBMZZYIRSA-N |
| XLogP | -0.21 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.53 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|