C12H18Cl3N3O8 — CID 142320905
(2R,3R,4R,5R,6R)-2-azido-2-[(2R,3S,4S,5S)-2,5-bis(chloromethyl)-3,4-dihydroxyoxolan-2-yl]oxy-5-chloro-6-(hydroxymethyl)oxane-3,4-diol (PubChem CID 142320905) has the molecular formula C12H18Cl3N3O8 and a molecular weight of 438.65 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-2-azido-2-[(2R,3S,4S,5S)-2,5-bis(chloromethyl)-3,4-dihydroxyoxolan-2-yl]oxy-5-chloro-6-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5R,6R)-2-azido-2-[(2R,3S,4S,5S)-2,5-bis(chloromethyl)-3,4-dihydroxyoxolan-2-yl]oxy-5-chloro-6-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 142320905 |
| Molecular Formula | C12H18Cl3N3O8 |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 437.02 |
| IUPAC Name | (2R,3R,4R,5R,6R)-2-azido-2-[(2R,3S,4S,5S)-2,5-bis(chloromethyl)-3,4-dihydroxyoxolan-2-yl]oxy-5-chloro-6-(hydroxymethyl)oxane-3,4-diol |
| SMILES | [N-]=[N+]=N[C@@]1(O[C@]2(CCl)O[C@H](CCl)[C@@H](O)[C@@H]2O)O[C@H](CO)[C@H](Cl)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H18Cl3N3O8/c13-1-4-7(20)9(22)11(3-14,24-4)26-12(17-18-16)10(23)8(21)6(15)5(2-19)25-12/h4-10,19-23H,1-3H2/t4-,5-,6+,7-,8+,9+,10-,11+,12-/m1/s1 |
| InChIKey | POAHLDRQUOKMPR-FIXBQHDHSA-N |
| XLogP | -1.02 |
| TPSA | 177.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|