C8H16O7S — CID 70209053
(2R,3S,4S,5R)-2-(2-hydroxyethylsulfanyloxy)-2,5-bis(hydroxymethyl)oxolane-3,4-diol (PubChem CID 70209053) has the molecular formula C8H16O7S and a molecular weight of 256.28 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-(2-hydroxyethylsulfanyloxy)-2,5-bis(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4S,5R)-2-(2-hydroxyethylsulfanyloxy)-2,5-bis(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 70209053 |
| Molecular Formula | C8H16O7S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | (2R,3S,4S,5R)-2-(2-hydroxyethylsulfanyloxy)-2,5-bis(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OCCSO[C@@]1(CO)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H16O7S/c9-1-2-16-15-8(4-11)7(13)6(12)5(3-10)14-8/h5-7,9-13H,1-4H2/t5-,6-,7+,8-/m1/s1 |
| InChIKey | XPONAABZRHYUOE-OOJXKGFFSA-N |
| XLogP | -2.56 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|