C12H25NO6 — CID 140646128
(2S,3R,4S,5R,6R)-2-(hexylamino)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 140646128) has the molecular formula C12H25NO6 and a molecular weight of 279.33 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-(hexylamino)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,4S,5R,6R)-2-(hexylamino)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 140646128 |
| Molecular Formula | C12H25NO6 |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-(hexylamino)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | CCCCCCN[C@@]1(O)O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H25NO6/c1-2-3-4-5-6-13-12(18)11(17)10(16)9(15)8(7-14)19-12/h8-11,13-18H,2-7H2,1H3/t8-,9+,10+,11-,12+/m1/s1 |
| InChIKey | VUSUAIQLXSVDFX-IIRVCBMXSA-N |
| XLogP | -1.72 |
| TPSA | 122.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|