C12H22F2O6 — CID 68573725
(2S,3R,4S,5S,6R)-2-(difluoromethyl)-6-(hydroxymethyl)-2-pentoxyoxane-3,4,5-triol (PubChem CID 68573725) has the molecular formula C12H22F2O6 and a molecular weight of 300.30 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-(difluoromethyl)-6-(hydroxymethyl)-2-pentoxyoxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-(difluoromethyl)-6-(hydroxymethyl)-2-pentoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 68573725 |
| Molecular Formula | C12H22F2O6 |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-(difluoromethyl)-6-(hydroxymethyl)-2-pentoxyoxane-3,4,5-triol |
| SMILES | CCCCCO[C@]1(C(F)F)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H22F2O6/c1-2-3-4-5-19-12(11(13)14)10(18)9(17)8(16)7(6-15)20-12/h7-11,15-18H,2-6H2,1H3/t7-,8-,9+,10-,12+/m1/s1 |
| InChIKey | DFQGVZVDHWOYCW-GPTQDWHKSA-N |
| XLogP | -0.37 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|