C27H48O7 — CID 67767713
[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-propan-2-yloxan-2-yl] octadeca-9,12-dienoate (PubChem CID 67767713) has the molecular formula C27H48O7 and a molecular weight of 484.67 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-propan-2-yloxan-2-yl] octadeca-9,12-dienoate.
| Compound Name | [(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-propan-2-yloxan-2-yl] octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 67767713 |
| Molecular Formula | C27H48O7 |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.34 |
| IUPAC Name | [(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-propan-2-yloxan-2-yl] octadeca-9,12-dienoate |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)OC1(C(C)C)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C27H48O7/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(29)34-27(21(2)3)26(32)25(31)24(30)22(20-28)33-27/h8-9,11-12,21-22,24-26,28,30-32H,4-7,10,13-20H2,1-3H3/t22-,24-,25+,26-,27?/m1/s1 |
| InChIKey | XHQWMUJHIIIAEQ-PMGSSBBTSA-N |
| XLogP | 4.17 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|