C27H46O10 — CID 141367297
[(3R,4S,5S,6R)-2-(3-deuterio-2,3-dihydroxypropanoyl)-2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl] octadeca-9,12-dienoate (PubChem CID 141367297) has the molecular formula C27H46O10 and a molecular weight of 531.66 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-2-(3-deuterio-2,3-dihydroxypropanoyl)-2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl] octadeca-9,12-dienoate.
| Compound Name | [(3R,4S,5S,6R)-2-(3-deuterio-2,3-dihydroxypropanoyl)-2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl] octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 141367297 |
| Molecular Formula | C27H46O10 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.32 |
| IUPAC Name | [(3R,4S,5S,6R)-2-(3-deuterio-2,3-dihydroxypropanoyl)-2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl] octadeca-9,12-dienoate |
| SMILES | [2H]C(O)C(O)C(=O)C1(O)O[C@H](CO)[C@H](O)[C@H](OC(=O)CCCCCCCC=CCC=CCCCCC)[C@H]1O |
| InChI | InChI=1S/C27H46O10/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(31)36-24-23(32)21(19-29)37-27(35,26(24)34)25(33)20(30)18-28/h6-7,9-10,20-21,23-24,26,28-30,32,34-35H,2-5,8,11-19H2,1H3/t20?,21-,23+,24+,26-,27?/m1/s1/i18D/t18?,20?,21-,23+,24+,26-,27? |
| InChIKey | PJZGQCJNZQZKHR-WDZHXLKHSA-N |
| XLogP | 1.44 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|