C59H106O8 — CID 165379544
[(2R,3S,5S)-2-(hydroxymethyl)-4,5-bis[[(Z)-octadec-9-enoyl]oxy]oxolan-3-yl] (Z)-octadec-9-enoate (PubChem CID 165379544) has the molecular formula C59H106O8 and a molecular weight of 943.49 g/mol. Its IUPAC name is [(2R,3S,5S)-2-(hydroxymethyl)-4,5-bis[[(Z)-octadec-9-enoyl]oxy]oxolan-3-yl] (Z)-octadec-9-enoate.
| Compound Name | [(2R,3S,5S)-2-(hydroxymethyl)-4,5-bis[[(Z)-octadec-9-enoyl]oxy]oxolan-3-yl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 165379544 |
| Molecular Formula | C59H106O8 |
| Molecular Weight | 943.49 g/mol |
| Exact Mass | 942.79 |
| IUPAC Name | [(2R,3S,5S)-2-(hydroxymethyl)-4,5-bis[[(Z)-octadec-9-enoyl]oxy]oxolan-3-yl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC1[C@H](OC(=O)CCCCCCC/C=C\CCCCCCCC)O[C@H](CO)[C@@H]1OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C59H106O8/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-54(61)65-57-53(52-60)64-59(67-56(63)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)58(57)66-55(62)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h25-30,53,57-60H,4-24,31-52H2,1-3H3/b28-25-,29-26-,30-27-/t53-,57+,58?,59+/m1/s1 |
| InChIKey | UCDATLWENPTUBE-GMNOEPOCSA-N |
| XLogP | 17.18 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.49 |
| LogP ≤ 5 | 17.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|