C64H117NO8 — CID 164733217
[(2S,3S,5R)-5-[3-(dimethylamino)propanoyloxymethyl]-4-[(Z)-octadec-9-enoxy]-2-[(Z)-octadec-9-enoyl]oxyoxolan-3-yl] (Z)-octadec-9-enoate (PubChem CID 164733217) has the molecular formula C64H117NO8 and a molecular weight of 1028.64 g/mol. Its IUPAC name is [(2S,3S,5R)-5-[3-(dimethylamino)propanoyloxymethyl]-4-[(Z)-octadec-9-enoxy]-2-[(Z)-octadec-9-enoyl]oxyoxolan-3-yl] (Z)-octadec-9-enoate.
| Compound Name | [(2S,3S,5R)-5-[3-(dimethylamino)propanoyloxymethyl]-4-[(Z)-octadec-9-enoxy]-2-[(Z)-octadec-9-enoyl]oxyoxolan-3-yl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 164733217 |
| Molecular Formula | C64H117NO8 |
| Molecular Weight | 1028.64 g/mol |
| Exact Mass | 1027.88 |
| IUPAC Name | [(2S,3S,5R)-5-[3-(dimethylamino)propanoyloxymethyl]-4-[(Z)-octadec-9-enoxy]-2-[(Z)-octadec-9-enoyl]oxyoxolan-3-yl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOC1[C@@H](COC(=O)CCN(C)C)O[C@@H](OC(=O)CCCCCCC/C=C\CCCCCCCC)[C@H]1OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C64H117NO8/c1-6-9-12-15-18-21-24-27-30-33-36-39-42-45-48-51-56-69-62-58(57-70-59(66)54-55-65(4)5)71-64(73-61(68)53-50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-3)63(62)72-60(67)52-49-46-43-40-37-34-31-28-25-22-19-16-13-10-7-2/h27-32,58,62-64H,6-26,33-57H2,1-5H3/b30-27-,31-28-,32-29-/t58-,62?,63+,64+/m1/s1 |
| InChIKey | HNYLJYHFFWZVPU-BZPZVFFBSA-N |
| XLogP | 18.16 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1028.64 |
| LogP ≤ 5 | 18.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|