C59H116N2O9 — CID 153365546
[(2R,3S,4S,5S)-5-[3-(dimethylamino)propanoyloxy]-3,4-bis[9-(3-pentyloctoxy)nonoxy]oxolan-2-yl]methyl 3-(dimethylamino)propanoate (PubChem CID 153365546) has the molecular formula C59H116N2O9 and a molecular weight of 997.58 g/mol. Its IUPAC name is [(2R,3S,4S,5S)-5-[3-(dimethylamino)propanoyloxy]-3,4-bis[9-(3-pentyloctoxy)nonoxy]oxolan-2-yl]methyl 3-(dimethylamino)propanoate.
| Compound Name | [(2R,3S,4S,5S)-5-[3-(dimethylamino)propanoyloxy]-3,4-bis[9-(3-pentyloctoxy)nonoxy]oxolan-2-yl]methyl 3-(dimethylamino)propanoate |
|---|---|
| PubChem CID | 153365546 |
| Molecular Formula | C59H116N2O9 |
| Molecular Weight | 997.58 g/mol |
| Exact Mass | 996.87 |
| IUPAC Name | [(2R,3S,4S,5S)-5-[3-(dimethylamino)propanoyloxy]-3,4-bis[9-(3-pentyloctoxy)nonoxy]oxolan-2-yl]methyl 3-(dimethylamino)propanoate |
| SMILES | CCCCCC(CCCCC)CCOCCCCCCCCCO[C@@H]1[C@H](OC(=O)CCN(C)C)O[C@H](COC(=O)CCN(C)C)[C@@H]1OCCCCCCCCCOCCC(CCCCC)CCCCC |
| InChI | InChI=1S/C59H116N2O9/c1-9-13-27-35-52(36-28-14-10-2)41-49-64-45-31-23-19-17-21-25-33-47-66-57-54(51-68-55(62)39-43-60(5)6)69-59(70-56(63)40-44-61(7)8)58(57)67-48-34-26-22-18-20-24-32-46-65-50-42-53(37-29-15-11-3)38-30-16-12-4/h52-54,57-59H,9-51H2,1-8H3/t54-,57+,58+,59+/m1/s1 |
| InChIKey | YJHMGGDVVYGCDT-BMXUNVKSSA-N |
| XLogP | 14.30 |
| TPSA | 105.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 53 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 997.58 |
| LogP ≤ 5 | 14.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|