C57H108N2O11 — CID 165379701
3-pentyloctyl 9-[(2R,4S,5S)-5-[2-(dimethylamino)acetyl]oxy-2-[[2-(dimethylamino)acetyl]oxymethyl]-4-[9-oxo-9-(3-pentyloctoxy)nonoxy]oxolan-3-yl]oxynonanoate (PubChem CID 165379701) has the molecular formula C57H108N2O11 and a molecular weight of 997.49 g/mol. Its IUPAC name is 3-pentyloctyl 9-[(2R,4S,5S)-5-[2-(dimethylamino)acetyl]oxy-2-[[2-(dimethylamino)acetyl]oxymethyl]-4-[9-oxo-9-(3-pentyloctoxy)nonoxy]oxolan-3-yl]oxynonanoate.
| Compound Name | 3-pentyloctyl 9-[(2R,4S,5S)-5-[2-(dimethylamino)acetyl]oxy-2-[[2-(dimethylamino)acetyl]oxymethyl]-4-[9-oxo-9-(3-pentyloctoxy)nonoxy]oxolan-3-yl]oxynonanoate |
|---|---|
| PubChem CID | 165379701 |
| Molecular Formula | C57H108N2O11 |
| Molecular Weight | 997.49 g/mol |
| Exact Mass | 996.80 |
| IUPAC Name | 3-pentyloctyl 9-[(2R,4S,5S)-5-[2-(dimethylamino)acetyl]oxy-2-[[2-(dimethylamino)acetyl]oxymethyl]-4-[9-oxo-9-(3-pentyloctoxy)nonoxy]oxolan-3-yl]oxynonanoate |
| SMILES | CCCCCC(CCCCC)CCOC(=O)CCCCCCCCOC1[C@@H](COC(=O)CN(C)C)O[C@@H](OC(=O)CN(C)C)[C@H]1OCCCCCCCCC(=O)OCCC(CCCCC)CCCCC |
| InChI | InChI=1S/C57H108N2O11/c1-9-13-25-33-48(34-26-14-10-2)39-43-64-51(60)37-29-21-17-19-23-31-41-66-55-50(47-68-53(62)45-58(5)6)69-57(70-54(63)46-59(7)8)56(55)67-42-32-24-20-18-22-30-38-52(61)65-44-40-49(35-27-15-11-3)36-28-16-12-4/h48-50,55-57H,9-47H2,1-8H3/t50-,55?,56+,57+/m1/s1 |
| InChIKey | QBXPIHWGUDETAD-TXIMSRFYSA-N |
| XLogP | 12.57 |
| TPSA | 139.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 997.49 |
| LogP ≤ 5 | 12.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|