C29H53NO8 — CID 153365530
[(2R,3S,4S,5R)-4-decanoyloxy-2-[[2-(dimethylamino)acetyl]oxymethyl]-5-hydroxyoxolan-3-yl] decanoate (PubChem CID 153365530) has the molecular formula C29H53NO8 and a molecular weight of 543.74 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-4-decanoyloxy-2-[[2-(dimethylamino)acetyl]oxymethyl]-5-hydroxyoxolan-3-yl] decanoate.
| Compound Name | [(2R,3S,4S,5R)-4-decanoyloxy-2-[[2-(dimethylamino)acetyl]oxymethyl]-5-hydroxyoxolan-3-yl] decanoate |
|---|---|
| PubChem CID | 153365530 |
| Molecular Formula | C29H53NO8 |
| Molecular Weight | 543.74 g/mol |
| Exact Mass | 543.38 |
| IUPAC Name | [(2R,3S,4S,5R)-4-decanoyloxy-2-[[2-(dimethylamino)acetyl]oxymethyl]-5-hydroxyoxolan-3-yl] decanoate |
| SMILES | CCCCCCCCCC(=O)O[C@@H]1[C@H](OC(=O)CCCCCCCCC)[C@H](O)O[C@@H]1COC(=O)CN(C)C |
| InChI | InChI=1S/C29H53NO8/c1-5-7-9-11-13-15-17-19-24(31)37-27-23(22-35-26(33)21-30(3)4)36-29(34)28(27)38-25(32)20-18-16-14-12-10-8-6-2/h23,27-29,34H,5-22H2,1-4H3/t23-,27+,28+,29-/m1/s1 |
| InChIKey | HGPRGXODHATDDU-FQYQUSJJSA-N |
| XLogP | 4.91 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.74 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|