C31H54O10 — CID 2795279
[(2R,3R,4S,5R,6S)-3,4,5-tri(hexanoyloxy)-6-methoxyoxan-2-yl]methyl hexanoate (PubChem CID 2795279) has the molecular formula C31H54O10 and a molecular weight of 586.76 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-tri(hexanoyloxy)-6-methoxyoxan-2-yl]methyl hexanoate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-tri(hexanoyloxy)-6-methoxyoxan-2-yl]methyl hexanoate |
|---|---|
| PubChem CID | 2795279 |
| Molecular Formula | C31H54O10 |
| Molecular Weight | 586.76 g/mol |
| Exact Mass | 586.37 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-tri(hexanoyloxy)-6-methoxyoxan-2-yl]methyl hexanoate |
| SMILES | CCCCCC(=O)OC[C@H]1O[C@H](OC)[C@H](OC(=O)CCCCC)[C@@H](OC(=O)CCCCC)[C@@H]1OC(=O)CCCCC |
| InChI | InChI=1S/C31H54O10/c1-6-10-14-18-24(32)37-22-23-28(39-25(33)19-15-11-7-2)29(40-26(34)20-16-12-8-3)30(31(36-5)38-23)41-27(35)21-17-13-9-4/h23,28-31H,6-22H2,1-5H3/t23-,28-,29+,30-,31+/m1/s1 |
| InChIKey | AQBYLXRIYWTXQY-DFYRYSMESA-N |
| XLogP | 5.96 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.76 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|