C23H38O10 — CID 146662906
[(2R,3S,4S,5R,6S)-3,4,5-tri(butanoyloxy)-6-methoxyoxan-2-yl]methyl butanoate (PubChem CID 146662906) has the molecular formula C23H38O10 and a molecular weight of 474.55 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-tri(butanoyloxy)-6-methoxyoxan-2-yl]methyl butanoate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-tri(butanoyloxy)-6-methoxyoxan-2-yl]methyl butanoate |
|---|---|
| PubChem CID | 146662906 |
| Molecular Formula | C23H38O10 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-tri(butanoyloxy)-6-methoxyoxan-2-yl]methyl butanoate |
| SMILES | CCCC(=O)OC[C@H]1O[C@H](OC)[C@H](OC(=O)CCC)[C@@H](OC(=O)CCC)[C@H]1OC(=O)CCC |
| InChI | InChI=1S/C23H38O10/c1-6-10-16(24)29-14-15-20(31-17(25)11-7-2)21(32-18(26)12-8-3)22(23(28-5)30-15)33-19(27)13-9-4/h15,20-23H,6-14H2,1-5H3/t15-,20+,21+,22-,23+/m1/s1 |
| InChIKey | IBJZBXNEJKAOSD-IQGNASQBSA-N |
| XLogP | 2.84 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|