C22H37NO12S — CID 51349599
[(2R,3R,4S,5R,6S)-4,5,6-tri(butanoyloxy)-2-(sulfamoyloxymethyl)oxan-3-yl] butanoate (PubChem CID 51349599) has the molecular formula C22H37NO12S and a molecular weight of 539.60 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-4,5,6-tri(butanoyloxy)-2-(sulfamoyloxymethyl)oxan-3-yl] butanoate.
| Compound Name | [(2R,3R,4S,5R,6S)-4,5,6-tri(butanoyloxy)-2-(sulfamoyloxymethyl)oxan-3-yl] butanoate |
|---|---|
| PubChem CID | 51349599 |
| Molecular Formula | C22H37NO12S |
| Molecular Weight | 539.60 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-4,5,6-tri(butanoyloxy)-2-(sulfamoyloxymethyl)oxan-3-yl] butanoate |
| SMILES | CCCC(=O)O[C@@H]1O[C@H](COS(N)(=O)=O)[C@@H](OC(=O)CCC)[C@H](OC(=O)CCC)[C@H]1OC(=O)CCC |
| InChI | InChI=1S/C22H37NO12S/c1-5-9-15(24)32-19-14(13-30-36(23,28)29)31-22(35-18(27)12-8-4)21(34-17(26)11-7-3)20(19)33-16(25)10-6-2/h14,19-22H,5-13H2,1-4H3,(H2,23,28,29)/t14-,19-,20+,21-,22+/m1/s1 |
| InChIKey | GBYHMYCPXLFBCT-ZNJPAIRDSA-N |
| XLogP | 1.41 |
| TPSA | 183.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.60 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|