C36H52O21 — CID 10033376
1-O-ethyl 4-O-[[(2R,3R,4S,5R,6S)-3,4,5,6-tetrakis[(4-ethoxy-4-oxobutanoyl)oxy]oxan-2-yl]methyl] butanedioate (PubChem CID 10033376) has the molecular formula C36H52O21 and a molecular weight of 820.79 g/mol. Its IUPAC name is 1-O-ethyl 4-O-[[(2R,3R,4S,5R,6S)-3,4,5,6-tetrakis[(4-ethoxy-4-oxobutanoyl)oxy]oxan-2-yl]methyl] butanedioate.
| Compound Name | 1-O-ethyl 4-O-[[(2R,3R,4S,5R,6S)-3,4,5,6-tetrakis[(4-ethoxy-4-oxobutanoyl)oxy]oxan-2-yl]methyl] butanedioate |
|---|---|
| PubChem CID | 10033376 |
| Molecular Formula | C36H52O21 |
| Molecular Weight | 820.79 g/mol |
| Exact Mass | 820.30 |
| IUPAC Name | 1-O-ethyl 4-O-[[(2R,3R,4S,5R,6S)-3,4,5,6-tetrakis[(4-ethoxy-4-oxobutanoyl)oxy]oxan-2-yl]methyl] butanedioate |
| SMILES | CCOC(=O)CCC(=O)OC[C@H]1O[C@@H](OC(=O)CCC(=O)OCC)[C@H](OC(=O)CCC(=O)OCC)[C@@H](OC(=O)CCC(=O)OCC)[C@@H]1OC(=O)CCC(=O)OCC |
| InChI | InChI=1S/C36H52O21/c1-6-47-23(37)11-12-28(42)52-21-22-33(54-29(43)17-13-24(38)48-7-2)34(55-30(44)18-14-25(39)49-8-3)35(56-31(45)19-15-26(40)50-9-4)36(53-22)57-32(46)20-16-27(41)51-10-5/h22,33-36H,6-21H2,1-5H3/t22-,33-,34+,35-,36+/m1/s1 |
| InChIKey | VFUGEHCTJRKGRM-HJOMJFGVSA-N |
| XLogP | 1.25 |
| TPSA | 272.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.79 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|