C16H17Cl5O11 — CID 89198404
[(3R,4S,5R)-3,4,5,6-tetrakis[(2-chloroacetyl)oxy]oxan-2-yl]methyl 2-chloroacetate (PubChem CID 89198404) has the molecular formula C16H17Cl5O11 and a molecular weight of 562.57 g/mol. Its IUPAC name is [(3R,4S,5R)-3,4,5,6-tetrakis[(2-chloroacetyl)oxy]oxan-2-yl]methyl 2-chloroacetate.
| Compound Name | [(3R,4S,5R)-3,4,5,6-tetrakis[(2-chloroacetyl)oxy]oxan-2-yl]methyl 2-chloroacetate |
|---|---|
| PubChem CID | 89198404 |
| Molecular Formula | C16H17Cl5O11 |
| Molecular Weight | 562.57 g/mol |
| Exact Mass | 559.92 |
| IUPAC Name | [(3R,4S,5R)-3,4,5,6-tetrakis[(2-chloroacetyl)oxy]oxan-2-yl]methyl 2-chloroacetate |
| SMILES | O=C(CCl)OCC1OC(OC(=O)CCl)[C@H](OC(=O)CCl)[C@@H](OC(=O)CCl)[C@@H]1OC(=O)CCl |
| InChI | InChI=1S/C16H17Cl5O11/c17-1-8(22)27-6-7-13(29-9(23)2-18)14(30-10(24)3-19)15(31-11(25)4-20)16(28-7)32-12(26)5-21/h7,13-16H,1-6H2/t7?,13-,14+,15-,16?/m1/s1 |
| InChIKey | AMPORDCCVYGWRN-WAPHVBRRSA-N |
| XLogP | 0.73 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.57 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|